C24H25FN2O2 — CID 110549706
3-(3,4-dimethylphenyl)-1-(4-fluorophenyl)-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione (PubChem CID 110549706) has the molecular formula C24H25FN2O2 and a molecular weight of 392.47 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-(4-fluorophenyl)-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-1-(4-fluorophenyl)-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110549706 |
| Molecular Formula | C24H25FN2O2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-(4-fluorophenyl)-4-(3-methylpiperidin-1-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCCC(C)C3)C(=O)N(c3ccc(F)cc3)C2=O)cc1C |
| InChI | InChI=1S/C24H25FN2O2/c1-15-5-4-12-26(14-15)22-21(18-7-6-16(2)17(3)13-18)23(28)27(24(22)29)20-10-8-19(25)9-11-20/h6-11,13,15H,4-5,12,14H2,1-3H3 |
| InChIKey | YWFWGOSHYGUYQZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|