C24H24F2N2O3 — CID 110550826
1-(3,4-difluorophenyl)-3-(3,4-dimethylphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione (PubChem CID 110550826) has the molecular formula C24H24F2N2O3 and a molecular weight of 426.46 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(3,4-dimethylphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-(3,4-dimethylphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110550826 |
| Molecular Formula | C24H24F2N2O3 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(3,4-dimethylphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCCC(CO)C3)C(=O)N(c3ccc(F)c(F)c3)C2=O)cc1C |
| InChI | InChI=1S/C24H24F2N2O3/c1-14-5-6-17(10-15(14)2)21-22(27-9-3-4-16(12-27)13-29)24(31)28(23(21)30)18-7-8-19(25)20(26)11-18/h5-8,10-11,16,29H,3-4,9,12-13H2,1-2H3 |
| InChIKey | IOTKAANRRVBFFP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|