C22H19Cl2FN2O3 — CID 110545127
1-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione (PubChem CID 110545127) has the molecular formula C22H19Cl2FN2O3 and a molecular weight of 449.31 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110545127 |
| Molecular Formula | C22H19Cl2FN2O3 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(4-fluorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(F)cc2)=C(N2CCCC(CO)C2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2FN2O3/c23-17-8-7-16(10-18(17)24)27-21(29)19(14-3-5-15(25)6-4-14)20(22(27)30)26-9-1-2-13(11-26)12-28/h3-8,10,13,28H,1-2,9,11-12H2 |
| InChIKey | MLCXMWZTWQLBNF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|