C22H20Cl2N2O3 — CID 110562173
1-(2,5-dichlorophenyl)-3-[3-(hydroxymethyl)piperidin-1-yl]-4-phenylpyrrole-2,5-dione (PubChem CID 110562173) has the molecular formula C22H20Cl2N2O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[3-(hydroxymethyl)piperidin-1-yl]-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[3-(hydroxymethyl)piperidin-1-yl]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110562173 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[3-(hydroxymethyl)piperidin-1-yl]-4-phenylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccccc2)=C(N2CCCC(CO)C2)C(=O)N1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O3/c23-16-8-9-17(24)18(11-16)26-21(28)19(15-6-2-1-3-7-15)20(22(26)29)25-10-4-5-14(12-25)13-27/h1-3,6-9,11,14,27H,4-5,10,12-13H2 |
| InChIKey | DCLFLBUMXTYIFC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|