C24H24ClFN2O3 — CID 110569171
3-(4-chlorophenyl)-1-[2-(4-fluorophenyl)ethyl]-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione (PubChem CID 110569171) has the molecular formula C24H24ClFN2O3 and a molecular weight of 442.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[2-(4-fluorophenyl)ethyl]-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-1-[2-(4-fluorophenyl)ethyl]-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110569171 |
| Molecular Formula | C24H24ClFN2O3 |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[2-(4-fluorophenyl)ethyl]-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(Cl)cc2)=C(N2CCCC(CO)C2)C(=O)N1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H24ClFN2O3/c25-19-7-5-18(6-8-19)21-22(27-12-1-2-17(14-27)15-29)24(31)28(23(21)30)13-11-16-3-9-20(26)10-4-16/h3-10,17,29H,1-2,11-15H2 |
| InChIKey | UCNXQRPLABUQPN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|