C24H25ClFN3O3 — CID 110543154
1-[2-(4-chlorophenyl)ethyl]-3-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione (PubChem CID 110543154) has the molecular formula C24H25ClFN3O3 and a molecular weight of 457.93 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110543154 |
| Molecular Formula | C24H25ClFN3O3 |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(F)cc2)=C(N2CCN(CCO)CC2)C(=O)N1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H25ClFN3O3/c25-19-5-1-17(2-6-19)9-10-29-23(31)21(18-3-7-20(26)8-4-18)22(24(29)32)28-13-11-27(12-14-28)15-16-30/h1-8,30H,9-16H2 |
| InChIKey | ZKZNAXKLHWTWDK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|