C22H21ClFN3O3 — CID 110545241
1-(3-chlorophenyl)-3-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione (PubChem CID 110545241) has the molecular formula C22H21ClFN3O3 and a molecular weight of 429.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione.
| Compound Name | 1-(3-chlorophenyl)-3-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110545241 |
| Molecular Formula | C22H21ClFN3O3 |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(F)cc2)=C(N2CCN(CCO)CC2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21ClFN3O3/c23-16-2-1-3-18(14-16)27-21(29)19(15-4-6-17(24)7-5-15)20(22(27)30)26-10-8-25(9-11-26)12-13-28/h1-7,14,28H,8-13H2 |
| InChIKey | MCEMRZKIPJGPTJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|