C24H26FN3O3 — CID 110579351
3-(2,4-dimethylphenyl)-1-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione (PubChem CID 110579351) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dimethylphenyl)-1-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110579351 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-(4-fluorophenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCN(CCO)CC3)C(=O)N(c3ccc(F)cc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H26FN3O3/c1-16-3-8-20(17(2)15-16)21-22(27-11-9-26(10-12-27)13-14-29)24(31)28(23(21)30)19-6-4-18(25)5-7-19/h3-8,15,29H,9-14H2,1-2H3 |
| InChIKey | BRJNWVKYJNYEHA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|