C24H25F2N3O2 — CID 110580494
1-(2,4-difluorophenyl)-3-(2,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110580494) has the molecular formula C24H25F2N3O2 and a molecular weight of 425.48 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110580494 |
| Molecular Formula | C24H25F2N3O2 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CCN1CCN(C2=C(c3ccc(C)cc3C)C(=O)N(c3ccc(F)cc3F)C2=O)CC1 |
| InChI | InChI=1S/C24H25F2N3O2/c1-4-27-9-11-28(12-10-27)22-21(18-7-5-15(2)13-16(18)3)23(30)29(24(22)31)20-8-6-17(25)14-19(20)26/h5-8,13-14H,4,9-12H2,1-3H3 |
| InChIKey | ZMKLDEFMIFXXRT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|