C23H23ClFN3O2 — CID 110545677
1-(4-chloro-2-methylphenyl)-3-(4-ethylpiperazin-1-yl)-4-(4-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110545677) has the molecular formula C23H23ClFN3O2 and a molecular weight of 427.91 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-(4-ethylpiperazin-1-yl)-4-(4-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-(4-ethylpiperazin-1-yl)-4-(4-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110545677 |
| Molecular Formula | C23H23ClFN3O2 |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-(4-ethylpiperazin-1-yl)-4-(4-fluorophenyl)pyrrole-2,5-dione |
| SMILES | CCN1CCN(C2=C(c3ccc(F)cc3)C(=O)N(c3ccc(Cl)cc3C)C2=O)CC1 |
| InChI | InChI=1S/C23H23ClFN3O2/c1-3-26-10-12-27(13-11-26)21-20(16-4-7-18(25)8-5-16)22(29)28(23(21)30)19-9-6-17(24)14-15(19)2/h4-9,14H,3,10-13H2,1-2H3 |
| InChIKey | UBSOARFSOLDBOJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|