C24H25F2N3O3 — CID 110580450
1-(3,4-difluorophenyl)-3-(2,4-dimethylphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione (PubChem CID 110580450) has the molecular formula C24H25F2N3O3 and a molecular weight of 441.48 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(2,4-dimethylphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-(2,4-dimethylphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110580450 |
| Molecular Formula | C24H25F2N3O3 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(2,4-dimethylphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCN(CCO)CC3)C(=O)N(c3ccc(F)c(F)c3)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H25F2N3O3/c1-15-3-5-18(16(2)13-15)21-22(28-9-7-27(8-10-28)11-12-30)24(32)29(23(21)31)17-4-6-19(25)20(26)14-17/h3-6,13-14,30H,7-12H2,1-2H3 |
| InChIKey | SXBXOIYHJUJFPA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|