C25H28ClN3O3 — CID 110580209
1-(3-chloro-4-methylphenyl)-3-(2,4-dimethylphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione (PubChem CID 110580209) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(2,4-dimethylphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(2,4-dimethylphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110580209 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(2,4-dimethylphenyl)-4-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCN(CCO)CC3)C(=O)N(c3ccc(C)c(Cl)c3)C2=O)c(C)c1 |
| InChI | InChI=1S/C25H28ClN3O3/c1-16-4-7-20(18(3)14-16)22-23(28-10-8-27(9-11-28)12-13-30)25(32)29(24(22)31)19-6-5-17(2)21(26)15-19/h4-7,14-15,30H,8-13H2,1-3H3 |
| InChIKey | WPSWLUKKMPUEKR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|