C24H33N3O2 — CID 110578687
1-cyclohexyl-3-(2,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110578687) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-cyclohexyl-3-(2,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578687 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 1-cyclohexyl-3-(2,4-dimethylphenyl)-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CCN1CCN(C2=C(c3ccc(C)cc3C)C(=O)N(C3CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C24H33N3O2/c1-4-25-12-14-26(15-13-25)22-21(20-11-10-17(2)16-18(20)3)23(28)27(24(22)29)19-8-6-5-7-9-19/h10-11,16,19H,4-9,12-15H2,1-3H3 |
| InChIKey | CZGYTYAFLOTSFQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|