C23H30ClN3O2 — CID 110569820
3-(4-chlorophenyl)-1-cycloheptyl-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110569820) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-cycloheptyl-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-1-cycloheptyl-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110569820 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-(4-chlorophenyl)-1-cycloheptyl-4-(4-ethylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CCN1CCN(C2=C(c3ccc(Cl)cc3)C(=O)N(C3CCCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C23H30ClN3O2/c1-2-25-13-15-26(16-14-25)21-20(17-9-11-18(24)12-10-17)22(28)27(23(21)29)19-7-5-3-4-6-8-19/h9-12,19H,2-8,13-16H2,1H3 |
| InChIKey | DNHXNMTUGPOQQH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|