C25H34N4O4 — CID 110571712
ethyl 4-[3-(4-ethylpiperazin-1-yl)-4-(4-methylphenyl)-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 110571712) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is ethyl 4-[3-(4-ethylpiperazin-1-yl)-4-(4-methylphenyl)-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(4-ethylpiperazin-1-yl)-4-(4-methylphenyl)-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110571712 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | ethyl 4-[3-(4-ethylpiperazin-1-yl)-4-(4-methylphenyl)-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(c3ccc(C)cc3)=C(N3CCN(CC)CC3)C2=O)CC1 |
| InChI | InChI=1S/C25H34N4O4/c1-4-26-14-16-27(17-15-26)22-21(19-8-6-18(3)7-9-19)23(30)29(24(22)31)20-10-12-28(13-11-20)25(32)33-5-2/h6-9,20H,4-5,10-17H2,1-3H3 |
| InChIKey | FJTPDKCHRGRXJZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|