C20H24N2O7 — CID 110581425
ethyl 4-[3-(3,4-dimethoxyphenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 110581425) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is ethyl 4-[3-(3,4-dimethoxyphenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(3,4-dimethoxyphenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110581425 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | ethyl 4-[3-(3,4-dimethoxyphenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(O)=C(c3ccc(OC)c(OC)c3)C2=O)CC1 |
| InChI | InChI=1S/C20H24N2O7/c1-4-29-20(26)21-9-7-13(8-10-21)22-18(24)16(17(23)19(22)25)12-5-6-14(27-2)15(11-12)28-3/h5-6,11,13,23H,4,7-10H2,1-3H3 |
| InChIKey | DEKUAVCFRNMNNC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|