C18H18ClN3O6 — CID 110580638
ethyl 4-[3-chloro-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 110580638) has the molecular formula C18H18ClN3O6 and a molecular weight of 407.81 g/mol. Its IUPAC name is ethyl 4-[3-chloro-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-chloro-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110580638 |
| Molecular Formula | C18H18ClN3O6 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | ethyl 4-[3-chloro-4-(4-nitrophenyl)-2,5-dioxopyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(Cl)=C(c3ccc([N+](=O)[O-])cc3)C2=O)CC1 |
| InChI | InChI=1S/C18H18ClN3O6/c1-2-28-18(25)20-9-7-12(8-10-20)21-16(23)14(15(19)17(21)24)11-3-5-13(6-4-11)22(26)27/h3-6,12H,2,7-10H2,1H3 |
| InChIKey | FLWGTCQJWWDHSX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|