C23H23N3O7S — CID 108691893
ethyl 4-[(4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate (PubChem CID 108691893) has the molecular formula C23H23N3O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is ethyl 4-[(4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108691893 |
| Molecular Formula | C23H23N3O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | ethyl 4-[(4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(=O)/C(=C(\O)c3ccc([N+](=O)[O-])cc3)C2c2cccs2)CC1 |
| InChI | InChI=1S/C23H23N3O7S/c1-2-33-23(30)24-11-9-15(10-12-24)25-19(17-4-3-13-34-17)18(21(28)22(25)29)20(27)14-5-7-16(8-6-14)26(31)32/h3-8,13,15,19,27H,2,9-12H2,1H3/b20-18- |
| InChIKey | SJMXABREAHUTIZ-ZZEZOPTASA-N |
| XLogP | 3.70 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|