C24H24N2O7S — CID 108691915
ethyl 4-[(4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate (PubChem CID 108691915) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is ethyl 4-[(4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108691915 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | ethyl 4-[(4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(=O)/C(=C(\O)c3ccc4c(c3)OCO4)C2c2cccs2)CC1 |
| InChI | InChI=1S/C24H24N2O7S/c1-2-31-24(30)25-9-7-15(8-10-25)26-20(18-4-3-11-34-18)19(22(28)23(26)29)21(27)14-5-6-16-17(12-14)33-13-32-16/h3-6,11-12,15,20,27H,2,7-10,13H2,1H3/b21-19- |
| InChIKey | DRWIYKUQEPBVHC-VZCXRCSSSA-N |
| XLogP | 3.52 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|