C22H23N3O5S — CID 108691895
ethyl 4-[(4Z)-4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate (PubChem CID 108691895) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is ethyl 4-[(4Z)-4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4Z)-4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108691895 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | ethyl 4-[(4Z)-4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(=O)/C(=C(\O)c3ccncc3)C2c2cccs2)CC1 |
| InChI | InChI=1S/C22H23N3O5S/c1-2-30-22(29)24-11-7-15(8-12-24)25-18(16-4-3-13-31-16)17(20(27)21(25)28)19(26)14-5-9-23-10-6-14/h3-6,9-10,13,15,18,26H,2,7-8,11-12H2,1H3/b19-17- |
| InChIKey | QKXTYJWVLTWUHM-ZPHPHTNESA-N |
| XLogP | 3.19 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|