C31H32N2O6S — CID 108691926
ethyl 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate (PubChem CID 108691926) has the molecular formula C31H32N2O6S and a molecular weight of 560.67 g/mol. Its IUPAC name is ethyl 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108691926 |
| Molecular Formula | C31H32N2O6S |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | ethyl 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(=O)/C(=C(\O)c3ccc(OCc4ccccc4)c(C)c3)C2c2cccs2)CC1 |
| InChI | InChI=1S/C31H32N2O6S/c1-3-38-31(37)32-15-13-23(14-16-32)33-27(25-10-7-17-40-25)26(29(35)30(33)36)28(34)22-11-12-24(20(2)18-22)39-19-21-8-5-4-6-9-21/h4-12,17-18,23,27,34H,3,13-16,19H2,1-2H3/b28-26- |
| InChIKey | RTYOROLINVUHAF-SGEDCAFJSA-N |
| XLogP | 5.68 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|