C18H25N3O6 — CID 6733776
1-O-ethyl 4-O-[4-(4-nitrophenyl)butyl] piperazine-1,4-dicarboxylate (PubChem CID 6733776) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[4-(4-nitrophenyl)butyl] piperazine-1,4-dicarboxylate.
| Compound Name | 1-O-ethyl 4-O-[4-(4-nitrophenyl)butyl] piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 6733776 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-O-ethyl 4-O-[4-(4-nitrophenyl)butyl] piperazine-1,4-dicarboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)OCCCCc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C18H25N3O6/c1-2-26-17(22)19-10-12-20(13-11-19)18(23)27-14-4-3-5-15-6-8-16(9-7-15)21(24)25/h6-9H,2-5,10-14H2,1H3 |
| InChIKey | MVWLUDBNJHBWST-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|