C19H23NO5 — CID 110581459
1-cycloheptyl-3-(3,4-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione (PubChem CID 110581459) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-cycloheptyl-3-(3,4-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione.
| Compound Name | 1-cycloheptyl-3-(3,4-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581459 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-cycloheptyl-3-(3,4-dimethoxyphenyl)-4-hydroxypyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(O)C(=O)N(C3CCCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C19H23NO5/c1-24-14-10-9-12(11-15(14)25-2)16-17(21)19(23)20(18(16)22)13-7-5-3-4-6-8-13/h9-11,13,21H,3-8H2,1-2H3 |
| InChIKey | MPUBGWSICQAGDP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|