C22H30N4O4S — CID 110552164
ethyl 4-[3-(4-ethylpiperazin-1-yl)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 110552164) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is ethyl 4-[3-(4-ethylpiperazin-1-yl)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(4-ethylpiperazin-1-yl)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110552164 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | ethyl 4-[3-(4-ethylpiperazin-1-yl)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)C(c3cccs3)=C(N3CCN(CC)CC3)C2=O)CC1 |
| InChI | InChI=1S/C22H30N4O4S/c1-3-23-11-13-24(14-12-23)19-18(17-6-5-15-31-17)20(27)26(21(19)28)16-7-9-25(10-8-16)22(29)30-4-2/h5-6,15-16H,3-4,7-14H2,1-2H3 |
| InChIKey | QJNMQCPEHFTROV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|