C26H31N3O2S — CID 110553211
1-cyclooctyl-3-(4-phenylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553211) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-cyclooctyl-3-(4-phenylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-cyclooctyl-3-(4-phenylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553211 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-cyclooctyl-3-(4-phenylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(c2cccs2)=C(N2CCN(c3ccccc3)CC2)C(=O)N1C1CCCCCCC1 |
| InChI | InChI=1S/C26H31N3O2S/c30-25-23(22-14-9-19-32-22)24(26(31)29(25)21-12-5-2-1-3-6-13-21)28-17-15-27(16-18-28)20-10-7-4-8-11-20/h4,7-11,14,19,21H,1-3,5-6,12-13,15-18H2 |
| InChIKey | PBHHUOQIRZXMPZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|