C21H28N2O3S — CID 110553191
1-cycloheptyl-3-[3-(hydroxymethyl)piperidin-1-yl]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553191) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is 1-cycloheptyl-3-[3-(hydroxymethyl)piperidin-1-yl]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-cycloheptyl-3-[3-(hydroxymethyl)piperidin-1-yl]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553191 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-cycloheptyl-3-[3-(hydroxymethyl)piperidin-1-yl]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(c2cccs2)=C(N2CCCC(CO)C2)C(=O)N1C1CCCCCC1 |
| InChI | InChI=1S/C21H28N2O3S/c24-14-15-7-5-11-22(13-15)19-18(17-10-6-12-27-17)20(25)23(21(19)26)16-8-3-1-2-4-9-16/h6,10,12,15-16,24H,1-5,7-9,11,13-14H2 |
| InChIKey | FDNRBKISDKVGHE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|