C24H26N2O2S — CID 110553170
1-cycloheptyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553170) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-cycloheptyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-cycloheptyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553170 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-cycloheptyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(c2cccs2)=C(N2CCc3ccccc3C2)C(=O)N1C1CCCCCC1 |
| InChI | InChI=1S/C24H26N2O2S/c27-23-21(20-12-7-15-29-20)22(24(28)26(23)19-10-3-1-2-4-11-19)25-14-13-17-8-5-6-9-18(17)16-25/h5-9,12,15,19H,1-4,10-11,13-14,16H2 |
| InChIKey | WKEVVUDJVZIRBT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|