C26H27N3O4 — CID 110541519
1-cycloheptyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(4-nitrophenyl)pyrrole-2,5-dione (PubChem CID 110541519) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-cycloheptyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(4-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 1-cycloheptyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(4-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110541519 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-cycloheptyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(4-nitrophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc([N+](=O)[O-])cc2)=C(N2CCc3ccccc3C2)C(=O)N1C1CCCCCC1 |
| InChI | InChI=1S/C26H27N3O4/c30-25-23(19-11-13-22(14-12-19)29(32)33)24(26(31)28(25)21-9-3-1-2-4-10-21)27-16-15-18-7-5-6-8-20(18)17-27/h5-8,11-14,21H,1-4,9-10,15-17H2 |
| InChIKey | SVPIZNQKLPZWLP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|