C24H24N2O4S — CID 110541560
1-cyclooctyl-3-(4-nitrophenyl)-4-phenylsulfanylpyrrole-2,5-dione (PubChem CID 110541560) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 1-cyclooctyl-3-(4-nitrophenyl)-4-phenylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-cyclooctyl-3-(4-nitrophenyl)-4-phenylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110541560 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 1-cyclooctyl-3-(4-nitrophenyl)-4-phenylsulfanylpyrrole-2,5-dione |
| SMILES | O=C1C(Sc2ccccc2)=C(c2ccc([N+](=O)[O-])cc2)C(=O)N1C1CCCCCCC1 |
| InChI | InChI=1S/C24H24N2O4S/c27-23-21(17-13-15-19(16-14-17)26(29)30)22(31-20-11-7-4-8-12-20)24(28)25(23)18-9-5-2-1-3-6-10-18/h4,7-8,11-16,18H,1-3,5-6,9-10H2 |
| InChIKey | LSOSGTYJNFLACS-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|