C24H20N2O3S — CID 110554996
3-(3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-methoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110554996) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-methoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-methoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554996 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)-1-(2-methoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccccc1N1C(=O)C(c2cccs2)=C(N2CCc3ccccc3C2)C1=O |
| InChI | InChI=1S/C24H20N2O3S/c1-29-19-10-5-4-9-18(19)26-23(27)21(20-11-6-14-30-20)22(24(26)28)25-13-12-16-7-2-3-8-17(16)15-25/h2-11,14H,12-13,15H2,1H3 |
| InChIKey | GIIZRWMCEYXKGO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|