C23H20N2O3S — CID 110592111
3-(3,5-dimethylanilino)-1-(2-methoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110592111) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-(3,5-dimethylanilino)-1-(2-methoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylanilino)-1-(2-methoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110592111 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 3-(3,5-dimethylanilino)-1-(2-methoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccccc1N1C(=O)C(Nc2cc(C)cc(C)c2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C23H20N2O3S/c1-14-11-15(2)13-16(12-14)24-21-20(19-9-6-10-29-19)22(26)25(23(21)27)17-7-4-5-8-18(17)28-3/h4-13,24H,1-3H3 |
| InChIKey | DOZYAXSBEOAVKC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|