C23H20N2O5S — CID 110591599
1-(2,5-dimethoxyphenyl)-3-(3-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110591599) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(3-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(3-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110591599 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(3-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1cccc(NC2=C(c3cccs3)C(=O)N(c3cc(OC)ccc3OC)C2=O)c1 |
| InChI | InChI=1S/C23H20N2O5S/c1-28-15-7-4-6-14(12-15)24-21-20(19-8-5-11-31-19)22(26)25(23(21)27)17-13-16(29-2)9-10-18(17)30-3/h4-13,24H,1-3H3 |
| InChIKey | AAAGUTLGNPLYHW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|