C24H22N2O6S — CID 110591598
3-(3,5-dimethoxyanilino)-1-(2,5-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110591598) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is 3-(3,5-dimethoxyanilino)-1-(2,5-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethoxyanilino)-1-(2,5-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110591598 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 3-(3,5-dimethoxyanilino)-1-(2,5-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1cc(NC2=C(c3cccs3)C(=O)N(c3cc(OC)ccc3OC)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C24H22N2O6S/c1-29-15-7-8-19(32-4)18(13-15)26-23(27)21(20-6-5-9-33-20)22(24(26)28)25-14-10-16(30-2)12-17(11-14)31-3/h5-13,25H,1-4H3 |
| InChIKey | HUJYLJCMZJWWOL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|