C22H18N2O4S — CID 110591778
3-(3,5-dimethoxyanilino)-1-phenyl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110591778) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is 3-(3,5-dimethoxyanilino)-1-phenyl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethoxyanilino)-1-phenyl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110591778 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3-(3,5-dimethoxyanilino)-1-phenyl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1cc(NC2=C(c3cccs3)C(=O)N(c3ccccc3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C22H18N2O4S/c1-27-16-11-14(12-17(13-16)28-2)23-20-19(18-9-6-10-29-18)21(25)24(22(20)26)15-7-4-3-5-8-15/h3-13,23H,1-2H3 |
| InChIKey | SKCCPEKKDADDQQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|