C23H18N2O6S — CID 110552025
3-(1,3-benzodioxol-5-ylamino)-1-(3,5-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552025) has the molecular formula C23H18N2O6S and a molecular weight of 450.47 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-1-(3,5-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-1-(3,5-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552025 |
| Molecular Formula | C23H18N2O6S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-1-(3,5-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)C(Nc3ccc4c(c3)OCO4)=C(c3cccs3)C2=O)c1 |
| InChI | InChI=1S/C23H18N2O6S/c1-28-15-9-14(10-16(11-15)29-2)25-22(26)20(19-4-3-7-32-19)21(23(25)27)24-13-5-6-17-18(8-13)31-12-30-17/h3-11,24H,12H2,1-2H3 |
| InChIKey | HIUVMMZRPVRJNB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|