C22H16N2O4S — CID 110554981
3-(1,3-benzodioxol-5-ylamino)-1-(4-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110554981) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-1-(4-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-1-(4-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554981 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-1-(4-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(Nc3ccc4c(c3)OCO4)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C22H16N2O4S/c1-13-4-7-15(8-5-13)24-21(25)19(18-3-2-10-29-18)20(22(24)26)23-14-6-9-16-17(11-14)28-12-27-16/h2-11,23H,12H2,1H3 |
| InChIKey | WJSIEKXPXRKIOU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|