C24H22N2O5S — CID 110590324
1-(3,5-dimethoxyphenyl)-3-(4-ethoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110590324) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-(4-ethoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-(4-ethoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110590324 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-(4-ethoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCOc1ccc(NC2=C(c3cccs3)C(=O)N(c3cc(OC)cc(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-4-31-17-9-7-15(8-10-17)25-22-21(20-6-5-11-32-20)23(27)26(24(22)28)16-12-18(29-2)14-19(13-16)30-3/h5-14,25H,4H2,1-3H3 |
| InChIKey | KVPCRKVWCMIPLT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|