C23H18N2O5S — CID 110590638
1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110590638) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110590638 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxyanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(NC2=C(c3cccs3)C(=O)N(Cc3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C23H18N2O5S/c1-28-16-7-5-15(6-8-16)24-21-20(19-3-2-10-31-19)22(26)25(23(21)27)12-14-4-9-17-18(11-14)30-13-29-17/h2-11,24H,12-13H2,1H3 |
| InChIKey | JUZUIALRAHINNB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|