C21H15N3O4S — CID 110552706
3-(1,3-benzodioxol-5-ylamino)-1-(pyridin-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552706) has the molecular formula C21H15N3O4S and a molecular weight of 405.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-1-(pyridin-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-1-(pyridin-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552706 |
| Molecular Formula | C21H15N3O4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-1-(pyridin-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(Nc2ccc3c(c2)OCO3)=C(c2cccs2)C(=O)N1Cc1ccccn1 |
| InChI | InChI=1S/C21H15N3O4S/c25-20-18(17-5-3-9-29-17)19(21(26)24(20)11-14-4-1-2-8-22-14)23-13-6-7-15-16(10-13)28-12-27-15/h1-10,23H,11-12H2 |
| InChIKey | STTGSTQJEGCRDJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|