C23H20N2O2S — CID 110590780
1-benzyl-3-(3,4-dimethylanilino)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110590780) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-dimethylanilino)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-(3,4-dimethylanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110590780 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-benzyl-3-(3,4-dimethylanilino)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1ccc(NC2=C(c3cccs3)C(=O)N(Cc3ccccc3)C2=O)cc1C |
| InChI | InChI=1S/C23H20N2O2S/c1-15-10-11-18(13-16(15)2)24-21-20(19-9-6-12-28-19)22(26)25(23(21)27)14-17-7-4-3-5-8-17/h3-13,24H,14H2,1-2H3 |
| InChIKey | NXKZXZPOPQNORR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|