C25H22N2O2 — CID 110588824
3-anilino-1-benzyl-4-(3,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110588824) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-anilino-1-benzyl-4-(3,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-anilino-1-benzyl-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110588824 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 3-anilino-1-benzyl-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(Nc3ccccc3)C(=O)N(Cc3ccccc3)C2=O)cc1C |
| InChI | InChI=1S/C25H22N2O2/c1-17-13-14-20(15-18(17)2)22-23(26-21-11-7-4-8-12-21)25(29)27(24(22)28)16-19-9-5-3-6-10-19/h3-15,26H,16H2,1-2H3 |
| InChIKey | SQANBJWJIITWGY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|