C25H21FN2O4 — CID 110596880
1-benzyl-3-(3,4-dimethoxyphenyl)-4-(3-fluoroanilino)pyrrole-2,5-dione (PubChem CID 110596880) has the molecular formula C25H21FN2O4 and a molecular weight of 432.45 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-dimethoxyphenyl)-4-(3-fluoroanilino)pyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-(3,4-dimethoxyphenyl)-4-(3-fluoroanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110596880 |
| Molecular Formula | C25H21FN2O4 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1-benzyl-3-(3,4-dimethoxyphenyl)-4-(3-fluoroanilino)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(Nc3cccc(F)c3)C(=O)N(Cc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C25H21FN2O4/c1-31-20-12-11-17(13-21(20)32-2)22-23(27-19-10-6-9-18(26)14-19)25(30)28(24(22)29)15-16-7-4-3-5-8-16/h3-14,27H,15H2,1-2H3 |
| InChIKey | MFBCBLSLODRAEX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|