C22H19N3O2S — CID 110590701
3-(2,3-dimethylanilino)-1-(pyridin-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110590701) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is 3-(2,3-dimethylanilino)-1-(pyridin-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(2,3-dimethylanilino)-1-(pyridin-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110590701 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-(2,3-dimethylanilino)-1-(pyridin-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1cccc(NC2=C(c3cccs3)C(=O)N(Cc3ccccn3)C2=O)c1C |
| InChI | InChI=1S/C22H19N3O2S/c1-14-7-5-9-17(15(14)2)24-20-19(18-10-6-12-28-18)21(26)25(22(20)27)13-16-8-3-4-11-23-16/h3-12,24H,13H2,1-2H3 |
| InChIKey | FHXDUBPZJJESMU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|