C24H21N3O3S — CID 110591952
N-[4-[3-(2,3-dimethylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]phenyl]acetamide (PubChem CID 110591952) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[4-[3-(2,3-dimethylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-(2,3-dimethylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110591952 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[4-[3-(2,3-dimethylanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C(Nc3cccc(C)c3C)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C24H21N3O3S/c1-14-6-4-7-19(15(14)2)26-22-21(20-8-5-13-31-20)23(29)27(24(22)30)18-11-9-17(10-12-18)25-16(3)28/h4-13,26H,1-3H3,(H,25,28) |
| InChIKey | MFHNIFBPDXWADQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|