C22H16N2O3S2 — CID 110554773
N-[4-(2,5-dioxo-3-phenylsulfanyl-4-thiophen-2-ylpyrrol-1-yl)phenyl]acetamide (PubChem CID 110554773) has the molecular formula C22H16N2O3S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[4-(2,5-dioxo-3-phenylsulfanyl-4-thiophen-2-ylpyrrol-1-yl)phenyl]acetamide.
| Compound Name | N-[4-(2,5-dioxo-3-phenylsulfanyl-4-thiophen-2-ylpyrrol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 110554773 |
| Molecular Formula | C22H16N2O3S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-[4-(2,5-dioxo-3-phenylsulfanyl-4-thiophen-2-ylpyrrol-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C(Sc3ccccc3)=C(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C22H16N2O3S2/c1-14(25)23-15-9-11-16(12-10-15)24-21(26)19(18-8-5-13-28-18)20(22(24)27)29-17-6-3-2-4-7-17/h2-13H,1H3,(H,23,25) |
| InChIKey | LVRSSABOFNFMBK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|