C15H11NO2S2 — CID 110553017
1-methyl-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553017) has the molecular formula C15H11NO2S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-methyl-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-methyl-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553017 |
| Molecular Formula | C15H11NO2S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 1-methyl-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CN1C(=O)C(Sc2ccccc2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C15H11NO2S2/c1-16-14(17)12(11-8-5-9-19-11)13(15(16)18)20-10-6-3-2-4-7-10/h2-9H,1H3 |
| InChIKey | DTQLXUPUIMROIP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|