C19H19NO2S2 — CID 110552861
1-pentyl-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552861) has the molecular formula C19H19NO2S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-pentyl-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-pentyl-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552861 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-pentyl-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCCCN1C(=O)C(Sc2ccccc2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C19H19NO2S2/c1-2-3-7-12-20-18(21)16(15-11-8-13-23-15)17(19(20)22)24-14-9-5-4-6-10-14/h4-6,8-11,13H,2-3,7,12H2,1H3 |
| InChIKey | RFQOIFHEABRVMN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|