C17H15NO3S2 — CID 110553079
1-(2-methoxyethyl)-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553079) has the molecular formula C17H15NO3S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(2-methoxyethyl)-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553079 |
| Molecular Formula | C17H15NO3S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 1-(2-methoxyethyl)-3-phenylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COCCN1C(=O)C(Sc2ccccc2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C17H15NO3S2/c1-21-10-9-18-16(19)14(13-8-5-11-22-13)15(17(18)20)23-12-6-3-2-4-7-12/h2-8,11H,9-10H2,1H3 |
| InChIKey | RJTRDQQJRDNVBD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|