C20H23NO2S2 — CID 132937304
1-octyl-3,4-dithiophen-2-ylpyrrole-2,5-dione (PubChem CID 132937304) has the molecular formula C20H23NO2S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 1-octyl-3,4-dithiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-octyl-3,4-dithiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 132937304 |
| Molecular Formula | C20H23NO2S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-octyl-3,4-dithiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCCCCCCN1C(=O)C(c2cccs2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C20H23NO2S2/c1-2-3-4-5-6-7-12-21-19(22)17(15-10-8-13-24-15)18(20(21)23)16-11-9-14-25-16/h8-11,13-14H,2-7,12H2,1H3 |
| InChIKey | SRSLCJHOPOWVCB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|