C21H30N2O2S — CID 110553714
1-octyl-3-piperidin-1-yl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553714) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is 1-octyl-3-piperidin-1-yl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-octyl-3-piperidin-1-yl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553714 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-octyl-3-piperidin-1-yl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCCCCCCN1C(=O)C(c2cccs2)=C(N2CCCCC2)C1=O |
| InChI | InChI=1S/C21H30N2O2S/c1-2-3-4-5-6-10-15-23-20(24)18(17-12-11-16-26-17)19(21(23)25)22-13-8-7-9-14-22/h11-12,16H,2-10,13-15H2,1H3 |
| InChIKey | FYXCTFGXNSIMBC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|